C33H66O6Si2 — CID 10770099
methyl (E,5R,6S,7R,8S,9R)-8-[tert-butyl(dimethyl)silyl]oxy-9-[(4R,5S)-2,2-ditert-butyl-5-methyl-1,3,2-dioxasilinan-4-yl]-4-ethyl-6-hydroxy-5,7-dimethyldec-3-enoate (PubChem CID 10770099) has the molecular formula C33H66O6Si2 and a molecular weight of 615.06 g/mol. Its IUPAC name is methyl (E,5R,6S,7R,8S,9R)-8-[tert-butyl(dimethyl)silyl]oxy-9-[(4R,5S)-2,2-ditert-butyl-5-methyl-1,3,2-dioxasilinan-4-yl]-4-ethyl-6-hydroxy-5,7-dimethyldec-3-enoate.
| Compound Name | methyl (E,5R,6S,7R,8S,9R)-8-[tert-butyl(dimethyl)silyl]oxy-9-[(4R,5S)-2,2-ditert-butyl-5-methyl-1,3,2-dioxasilinan-4-yl]-4-ethyl-6-hydroxy-5,7-dimethyldec-3-enoate |
|---|---|
| PubChem CID | 10770099 |
| Molecular Formula | C33H66O6Si2 |
| Molecular Weight | 615.06 g/mol |
| Exact Mass | 614.44 |
| IUPAC Name | methyl (E,5R,6S,7R,8S,9R)-8-[tert-butyl(dimethyl)silyl]oxy-9-[(4R,5S)-2,2-ditert-butyl-5-methyl-1,3,2-dioxasilinan-4-yl]-4-ethyl-6-hydroxy-5,7-dimethyldec-3-enoate |
| SMILES | CC/C(=C\CC(=O)OC)[C@@H](C)[C@H](O)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H]1O[Si](C(C)(C)C)(C(C)(C)C)OC[C@@H]1C |
| InChI | InChI=1S/C33H66O6Si2/c1-18-26(19-20-27(34)36-15)23(3)28(35)24(4)30(38-40(16,17)31(6,7)8)25(5)29-22(2)21-37-41(39-29,32(9,10)11)33(12,13)14/h19,22-25,28-30,35H,18,20-21H2,1-17H3/b26-19+/t22-,23+,24+,25-,28-,29+,30-/m0/s1 |
| InChIKey | UEXPSEKKZGNTGI-UBHWXZCKSA-N |
| XLogP | 8.64 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.06 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|