C28H50O4Si — CID 18636849
7-[(1R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4-methylnonyl]-5-hydroxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid (PubChem CID 18636849) has the molecular formula C28H50O4Si and a molecular weight of 478.79 g/mol. Its IUPAC name is 7-[(1R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4-methylnonyl]-5-hydroxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid.
| Compound Name | 7-[(1R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4-methylnonyl]-5-hydroxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
|---|---|
| PubChem CID | 18636849 |
| Molecular Formula | C28H50O4Si |
| Molecular Weight | 478.79 g/mol |
| Exact Mass | 478.35 |
| IUPAC Name | 7-[(1R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4-methylnonyl]-5-hydroxycyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
| SMILES | CCCCCC(C)C(CCC1=CC[C@H](O)[C@@H]1CCC=C=CCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H50O4Si/c1-8-9-12-15-22(2)26(32-33(6,7)28(3,4)5)21-19-23-18-20-25(29)24(23)16-13-10-11-14-17-27(30)31/h10,14,18,22,24-26,29H,8-9,12-13,15-17,19-21H2,1-7H3,(H,30,31)/t11?,22?,24-,25+,26?/m1/s1 |
| InChIKey | DIXIIMKYHBELJJ-BFXLCOCCSA-N |
| XLogP | 7.65 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.79 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|