C13H24O3 — CID 10775729
(3R,11R)-3-methoxydodec-6-yne-1,11-diol (PubChem CID 10775729) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is (3R,11R)-3-methoxydodec-6-yne-1,11-diol.
| Compound Name | (3R,11R)-3-methoxydodec-6-yne-1,11-diol |
|---|---|
| PubChem CID | 10775729 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (3R,11R)-3-methoxydodec-6-yne-1,11-diol |
| SMILES | CO[C@@H](CCO)CCC#CCCC[C@@H](C)O |
| InChI | InChI=1S/C13H24O3/c1-12(15)8-6-4-3-5-7-9-13(16-2)10-11-14/h12-15H,4,6-11H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | UGNMROJFNSMDJS-CHWSQXEVSA-N |
| XLogP | 1.72 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|