About 3-(2-amino-5,5-dimethylcyclohexyl)sulfanylbutan-2-ol
3-(2-amino-5,5-dimethylcyclohexyl)sulfanylbutan-2-ol (PubChem CID 107772656) has the molecular formula C12H25NOS
and a molecular weight of 231.41 g/mol. Its IUPAC name is 3-(2-amino-5,5-dimethylcyclohexyl)sulfanylbutan-2-ol.
Molecular Properties
| Compound Name | 3-(2-amino-5,5-dimethylcyclohexyl)sulfanylbutan-2-ol |
| PubChem CID | 107772656 |
| Molecular Formula | C12H25NOS |
| Molecular Weight | 231.41 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 3-(2-amino-5,5-dimethylcyclohexyl)sulfanylbutan-2-ol |
| SMILES | CC(O)C(C)SC1CC(C)(C)CCC1N |
| InChI | InChI=1S/C12H25NOS/c1-8(14)9(2)15-11-7-12(3,4)6-5-10(11)13/h8-11,14H,5-7,13H2,1-4H3 |
| InChIKey | TWBORFTXBGUJKK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-amino-5,5-dimethylcyclohexyl)sulfanylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-amino-5,5-dimethylcyclohexyl)sulfanylbutan-2-ol?
The IUPAC name of 3-(2-amino-5,5-dimethylcyclohexyl)sulfanylbutan-2-ol (CID 107772656) is 3-(2-amino-5,5-dimethylcyclohexyl)sulfanylbutan-2-ol.
What is the SMILES notation for 3-(2-amino-5,5-dimethylcyclohexyl)sulfanylbutan-2-ol?
The canonical SMILES for 3-(2-amino-5,5-dimethylcyclohexyl)sulfanylbutan-2-ol is CC(O)C(C)SC1CC(C)(C)CCC1N.
What is the InChIKey of 3-(2-amino-5,5-dimethylcyclohexyl)sulfanylbutan-2-ol?
The InChIKey is TWBORFTXBGUJKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NOS/c1-8(14)9(2)15-11-7-12(3,4)6-5-10(11)13/h8-11,14H,5-7,13H2,1-4H3.
What are the key properties of 3-(2-amino-5,5-dimethylcyclohexyl)sulfanylbutan-2-ol?
3-(2-amino-5,5-dimethylcyclohexyl)sulfanylbutan-2-ol has a molecular weight of 231.41 g/mol, XLogP of 2.39, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-amino-5,5-dimethylcyclohexyl)sulfanylbutan-2-ol is sourced from PubChem (CID 107772656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).