C12H25NOS — CID 107772656
3-(2-amino-5,5-dimethylcyclohexyl)sulfanylbutan-2-ol (PubChem CID 107772656) has the molecular formula C12H25NOS and a molecular weight of 231.41 g/mol. Its IUPAC name is 3-(2-amino-5,5-dimethylcyclohexyl)sulfanylbutan-2-ol.
| Compound Name | 3-(2-amino-5,5-dimethylcyclohexyl)sulfanylbutan-2-ol |
|---|---|
| PubChem CID | 107772656 |
| Molecular Formula | C12H25NOS |
| Molecular Weight | 231.41 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 3-(2-amino-5,5-dimethylcyclohexyl)sulfanylbutan-2-ol |
| SMILES | CC(O)C(C)SC1CC(C)(C)CCC1N |
| InChI | InChI=1S/C12H25NOS/c1-8(14)9(2)15-11-7-12(3,4)6-5-10(11)13/h8-11,14H,5-7,13H2,1-4H3 |
| InChIKey | TWBORFTXBGUJKK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |