C9H19OS+ — CID 10778753
dimethyl-[(1S,2S)-2-methylcyclohexyl]oxysulfanium (PubChem CID 10778753) has the molecular formula C9H19OS+ and a molecular weight of 175.32 g/mol. Its IUPAC name is dimethyl-[(1S,2S)-2-methylcyclohexyl]oxysulfanium.
| Compound Name | dimethyl-[(1S,2S)-2-methylcyclohexyl]oxysulfanium |
|---|---|
| PubChem CID | 10778753 |
| Molecular Formula | C9H19OS+ |
| Molecular Weight | 175.32 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | dimethyl-[(1S,2S)-2-methylcyclohexyl]oxysulfanium |
| SMILES | C[C@H]1CCCC[C@@H]1O[S+](C)C |
| InChI | InChI=1S/C9H19OS/c1-8-6-4-5-7-9(8)10-11(2)3/h8-9H,4-7H2,1-3H3/q+1/t8-,9-/m0/s1 |
| InChIKey | NBSJFLAHQIBHJV-IUCAKERBSA-N |
| XLogP | 2.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|