About dimethyl-[(1S,2S)-2-methylcyclohexyl]oxysulfanium
dimethyl-[(1S,2S)-2-methylcyclohexyl]oxysulfanium (PubChem CID 10778753) has the molecular formula C9H19OS+
and a molecular weight of 175.32 g/mol. Its IUPAC name is dimethyl-[(1S,2S)-2-methylcyclohexyl]oxysulfanium.
Molecular Properties
| Compound Name | dimethyl-[(1S,2S)-2-methylcyclohexyl]oxysulfanium |
| PubChem CID | 10778753 |
| Molecular Formula | C9H19OS+ |
| Molecular Weight | 175.32 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | dimethyl-[(1S,2S)-2-methylcyclohexyl]oxysulfanium |
| SMILES | C[C@H]1CCCC[C@@H]1O[S+](C)C |
| InChI | InChI=1S/C9H19OS/c1-8-6-4-5-7-9(8)10-11(2)3/h8-9H,4-7H2,1-3H3/q+1/t8-,9-/m0/s1 |
| InChIKey | NBSJFLAHQIBHJV-IUCAKERBSA-N |
| XLogP | 2.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-[(1S,2S)-2-methylcyclohexyl]oxysulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-[(1S,2S)-2-methylcyclohexyl]oxysulfanium?
The IUPAC name of dimethyl-[(1S,2S)-2-methylcyclohexyl]oxysulfanium (CID 10778753) is dimethyl-[(1S,2S)-2-methylcyclohexyl]oxysulfanium.
What is the SMILES notation for dimethyl-[(1S,2S)-2-methylcyclohexyl]oxysulfanium?
The canonical SMILES for dimethyl-[(1S,2S)-2-methylcyclohexyl]oxysulfanium is C[C@H]1CCCC[C@@H]1O[S+](C)C.
What is the InChIKey of dimethyl-[(1S,2S)-2-methylcyclohexyl]oxysulfanium?
The InChIKey is NBSJFLAHQIBHJV-IUCAKERBSA-N. The full InChI is InChI=1S/C9H19OS/c1-8-6-4-5-7-9(8)10-11(2)3/h8-9H,4-7H2,1-3H3/q+1/t8-,9-/m0/s1.
What are the key properties of dimethyl-[(1S,2S)-2-methylcyclohexyl]oxysulfanium?
dimethyl-[(1S,2S)-2-methylcyclohexyl]oxysulfanium has a molecular weight of 175.32 g/mol, XLogP of 2.37, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-[(1S,2S)-2-methylcyclohexyl]oxysulfanium is sourced from PubChem (CID 10778753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).