C7H14OS2 — CID 163542679
trans-(1R,2R)-1-(disulfanyloxy)-2-methylcyclohexane (PubChem CID 163542679) has the molecular formula C7H14OS2 and a molecular weight of 178.32 g/mol. Its IUPAC name is trans-(1R,2R)-1-(disulfanyloxy)-2-methylcyclohexane.
| Compound Name | trans-(1R,2R)-1-(disulfanyloxy)-2-methylcyclohexane |
|---|---|
| PubChem CID | 163542679 |
| Molecular Formula | C7H14OS2 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | trans-(1R,2R)-1-(disulfanyloxy)-2-methylcyclohexane |
| SMILES | C[C@@H]1CCCC[C@H]1OSS |
| InChI | InChI=1S/C7H14OS2/c1-6-4-2-3-5-7(6)8-10-9/h6-7,9H,2-5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | FCLAZKUTIZGHHU-RNFRBKRXSA-N |
| XLogP | 3.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|