C18H20N2O2 — CID 10780271
N-[(E)-[(4S,5S)-4,5-diphenyl-1,3-dioxolan-2-yl]methylideneamino]-N-methylmethanamine (PubChem CID 10780271) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is N-[(E)-[(4S,5S)-4,5-diphenyl-1,3-dioxolan-2-yl]methylideneamino]-N-methylmethanamine.
| Compound Name | N-[(E)-[(4S,5S)-4,5-diphenyl-1,3-dioxolan-2-yl]methylideneamino]-N-methylmethanamine |
|---|---|
| PubChem CID | 10780271 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N-[(E)-[(4S,5S)-4,5-diphenyl-1,3-dioxolan-2-yl]methylideneamino]-N-methylmethanamine |
| SMILES | CN(C)/N=C/C1O[C@@H](c2ccccc2)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C18H20N2O2/c1-20(2)19-13-16-21-17(14-9-5-3-6-10-14)18(22-16)15-11-7-4-8-12-15/h3-13,16-18H,1-2H3/b19-13+/t17-,18-/m0/s1 |
| InChIKey | CSTVUYKONWDASL-CVRYGXJASA-N |
| XLogP | 3.39 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|