C19H36O2Si — CID 10782257
(3R,3aS,8aR)-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-2,3,4,5,6,7,8,8a-octahydro-1H-azulen-3a-ol (PubChem CID 10782257) has the molecular formula C19H36O2Si and a molecular weight of 324.58 g/mol. Its IUPAC name is (3R,3aS,8aR)-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-2,3,4,5,6,7,8,8a-octahydro-1H-azulen-3a-ol.
| Compound Name | (3R,3aS,8aR)-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-2,3,4,5,6,7,8,8a-octahydro-1H-azulen-3a-ol |
|---|---|
| PubChem CID | 10782257 |
| Molecular Formula | C19H36O2Si |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | (3R,3aS,8aR)-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-2,3,4,5,6,7,8,8a-octahydro-1H-azulen-3a-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C/[C@H]1CC[C@H]2CCCCC[C@]21O |
| InChI | InChI=1S/C19H36O2Si/c1-18(2,3)22(4,5)21-15-9-11-17-13-12-16-10-7-6-8-14-19(16,17)20/h9,11,16-17,20H,6-8,10,12-15H2,1-5H3/b11-9+/t16-,17+,19+/m1/s1 |
| InChIKey | KVLYJWHUVBAOEQ-USZCMKDXSA-N |
| XLogP | 5.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|