C10H22N2O3S — CID 107865640
(2R)-2-amino-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4-methylsulfanylbutanamide (PubChem CID 107865640) has the molecular formula C10H22N2O3S and a molecular weight of 250.36 g/mol. Its IUPAC name is (2R)-2-amino-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-amino-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 107865640 |
| Molecular Formula | C10H22N2O3S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (2R)-2-amino-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4-methylsulfanylbutanamide |
| SMILES | CCC(CO)(CO)NC(=O)[C@H](N)CCSC |
| InChI | InChI=1S/C10H22N2O3S/c1-3-10(6-13,7-14)12-9(15)8(11)4-5-16-2/h8,13-14H,3-7,11H2,1-2H3,(H,12,15)/t8-/m1/s1 |
| InChIKey | PUQMTTNSLBWWQP-MRVPVSSYSA-N |
| XLogP | -0.68 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |