C10H20N2O3S — CID 104907366
methyl 2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]-2-methylpropanoate (PubChem CID 104907366) has the molecular formula C10H20N2O3S and a molecular weight of 248.35 g/mol. Its IUPAC name is methyl 2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]-2-methylpropanoate.
| Compound Name | methyl 2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 104907366 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | methyl 2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)NC(=O)[C@H](N)CCSC |
| InChI | InChI=1S/C10H20N2O3S/c1-10(2,9(14)15-3)12-8(13)7(11)5-6-16-4/h7H,5-6,11H2,1-4H3,(H,12,13)/t7-/m1/s1 |
| InChIKey | ODIQIXBXMLMURP-SSDOTTSWSA-N |
| XLogP | 0.13 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |