C21H36O6S3 — CID 10790900
1,10,19-trioxa-3,12,21-trithiacycloheptacosane-9,18,27-trione (PubChem CID 10790900) has the molecular formula C21H36O6S3 and a molecular weight of 480.71 g/mol. Its IUPAC name is 1,10,19-trioxa-3,12,21-trithiacycloheptacosane-9,18,27-trione.
| Compound Name | 1,10,19-trioxa-3,12,21-trithiacycloheptacosane-9,18,27-trione |
|---|---|
| PubChem CID | 10790900 |
| Molecular Formula | C21H36O6S3 |
| Molecular Weight | 480.71 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 1,10,19-trioxa-3,12,21-trithiacycloheptacosane-9,18,27-trione |
| SMILES | O=C1CCCCCSCOC(=O)CCCCCSCOC(=O)CCCCCSCO1 |
| InChI | InChI=1S/C21H36O6S3/c22-19-10-4-1-7-13-28-16-26-20(23)11-5-2-9-15-30-18-27-21(24)12-6-3-8-14-29-17-25-19/h1-18H2 |
| InChIKey | HLXAFHPXEKLSLJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.71 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|