C17H17NO5S2 — CID 1079384
propan-2-yl 2-methyl-5-(thiophen-2-ylsulfonylamino)-1-benzofuran-3-carboxylate (PubChem CID 1079384) has the molecular formula C17H17NO5S2 and a molecular weight of 379.46 g/mol. Its IUPAC name is propan-2-yl 2-methyl-5-(thiophen-2-ylsulfonylamino)-1-benzofuran-3-carboxylate.
| Compound Name | propan-2-yl 2-methyl-5-(thiophen-2-ylsulfonylamino)-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 1079384 |
| Molecular Formula | C17H17NO5S2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | propan-2-yl 2-methyl-5-(thiophen-2-ylsulfonylamino)-1-benzofuran-3-carboxylate |
| SMILES | Cc1oc2ccc(NS(=O)(=O)c3cccs3)cc2c1C(=O)OC(C)C |
| InChI | InChI=1S/C17H17NO5S2/c1-10(2)22-17(19)16-11(3)23-14-7-6-12(9-13(14)16)18-25(20,21)15-5-4-8-24-15/h4-10,18H,1-3H3 |
| InChIKey | PQYCGATYVFFNJO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |