C23H13N2O6SSe+ — CID 10793946
2,7-dinitro-9-(5-phenyl-1,3-thiaselenol-1-ium-2-yl)-9H-fluorene-4-carboxylic acid (PubChem CID 10793946) has the molecular formula C23H13N2O6SSe+ and a molecular weight of 524.39 g/mol. Its IUPAC name is 2,7-dinitro-9-(5-phenyl-1,3-thiaselenol-1-ium-2-yl)-9H-fluorene-4-carboxylic acid.
| Compound Name | 2,7-dinitro-9-(5-phenyl-1,3-thiaselenol-1-ium-2-yl)-9H-fluorene-4-carboxylic acid |
|---|---|
| PubChem CID | 10793946 |
| Molecular Formula | C23H13N2O6SSe+ |
| Molecular Weight | 524.39 g/mol |
| Exact Mass | 524.97 |
| IUPAC Name | 2,7-dinitro-9-(5-phenyl-1,3-thiaselenol-1-ium-2-yl)-9H-fluorene-4-carboxylic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc2c1-c1ccc([N+](=O)[O-])cc1C2c1[s+]c(-c2ccccc2)c[se]1 |
| InChI | InChI=1S/C23H12N2O6SSe/c26-22(27)18-10-14(25(30)31)9-17-20(18)15-7-6-13(24(28)29)8-16(15)21(17)23-32-19(11-33-23)12-4-2-1-3-5-12/h1-11,21H/p+1 |
| InChIKey | VXOPYPUFKUITQQ-UHFFFAOYSA-O |
| XLogP | 5.43 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.39 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|