C22H12N3O6SSe+ — CID 10770198
5-phenyl-2-(2,4,7-trinitro-9H-fluoren-9-yl)-1,3-thiaselenol-1-ium (PubChem CID 10770198) has the molecular formula C22H12N3O6SSe+ and a molecular weight of 525.38 g/mol. Its IUPAC name is 5-phenyl-2-(2,4,7-trinitro-9H-fluoren-9-yl)-1,3-thiaselenol-1-ium.
| Compound Name | 5-phenyl-2-(2,4,7-trinitro-9H-fluoren-9-yl)-1,3-thiaselenol-1-ium |
|---|---|
| PubChem CID | 10770198 |
| Molecular Formula | C22H12N3O6SSe+ |
| Molecular Weight | 525.38 g/mol |
| Exact Mass | 525.96 |
| IUPAC Name | 5-phenyl-2-(2,4,7-trinitro-9H-fluoren-9-yl)-1,3-thiaselenol-1-ium |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C(c1[s+]c(-c3ccccc3)c[se]1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1-2 |
| InChI | InChI=1S/C22H12N3O6SSe/c26-23(27)13-6-7-15-16(8-13)21(22-32-19(11-33-22)12-4-2-1-3-5-12)17-9-14(24(28)29)10-18(20(15)17)25(30)31/h1-11,21H/q+1 |
| InChIKey | GIIVYXJVHNBASG-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.38 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|