C29H12N6O8 — CID 90708886
2-[1-(2,4,5,7-tetranitro-9H-fluoren-9-yl)fluoren-9-ylidene]propanedinitrile (PubChem CID 90708886) has the molecular formula C29H12N6O8 and a molecular weight of 572.45 g/mol. Its IUPAC name is 2-[1-(2,4,5,7-tetranitro-9H-fluoren-9-yl)fluoren-9-ylidene]propanedinitrile.
| Compound Name | 2-[1-(2,4,5,7-tetranitro-9H-fluoren-9-yl)fluoren-9-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 90708886 |
| Molecular Formula | C29H12N6O8 |
| Molecular Weight | 572.45 g/mol |
| Exact Mass | 572.07 |
| IUPAC Name | 2-[1-(2,4,5,7-tetranitro-9H-fluoren-9-yl)fluoren-9-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1c2ccccc2-c2cccc(C3c4cc([N+](=O)[O-])cc([N+](=O)[O-])c4-c4c3cc([N+](=O)[O-])cc4[N+](=O)[O-])c21 |
| InChI | InChI=1S/C29H12N6O8/c30-12-14(13-31)25-18-5-2-1-4-17(18)19-6-3-7-20(27(19)25)26-21-8-15(32(36)37)10-23(34(40)41)28(21)29-22(26)9-16(33(38)39)11-24(29)35(42)43/h1-11,26H |
| InChIKey | IXJAJXRLMAXQFF-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 220.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.45 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|