C23H12N3O8S2+ — CID 10699083
2,5,7-trinitro-9-(4-phenyl-1,3-dithiol-1-ium-2-yl)-9H-fluorene-4-carboxylic acid (PubChem CID 10699083) has the molecular formula C23H12N3O8S2+ and a molecular weight of 522.50 g/mol. Its IUPAC name is 2,5,7-trinitro-9-(4-phenyl-1,3-dithiol-1-ium-2-yl)-9H-fluorene-4-carboxylic acid.
| Compound Name | 2,5,7-trinitro-9-(4-phenyl-1,3-dithiol-1-ium-2-yl)-9H-fluorene-4-carboxylic acid |
|---|---|
| PubChem CID | 10699083 |
| Molecular Formula | C23H12N3O8S2+ |
| Molecular Weight | 522.50 g/mol |
| Exact Mass | 522.01 |
| IUPAC Name | 2,5,7-trinitro-9-(4-phenyl-1,3-dithiol-1-ium-2-yl)-9H-fluorene-4-carboxylic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc2c1-c1c(cc([N+](=O)[O-])cc1[N+](=O)[O-])C2c1sc(-c2ccccc2)c[s+]1 |
| InChI | InChI=1S/C23H11N3O8S2/c27-22(28)16-8-12(24(29)30)6-14-19(16)21-15(7-13(25(31)32)9-17(21)26(33)34)20(14)23-35-10-18(36-23)11-4-2-1-3-5-11/h1-10,20H/p+1 |
| InChIKey | BGZLUFBYTXJJNW-UHFFFAOYSA-O |
| XLogP | 6.34 |
| TPSA | 166.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.50 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|