C16H18O — CID 10799279
2',3'-dimethylspiro[cyclohexane-3,1'-indene]-1-one (PubChem CID 10799279) has the molecular formula C16H18O and a molecular weight of 226.32 g/mol. Its IUPAC name is 2',3'-dimethylspiro[cyclohexane-3,1'-indene]-1-one.
| Compound Name | 2',3'-dimethylspiro[cyclohexane-3,1'-indene]-1-one |
|---|---|
| PubChem CID | 10799279 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 2',3'-dimethylspiro[cyclohexane-3,1'-indene]-1-one |
| SMILES | CC1=C(C)C2(CCCC(=O)C2)c2ccccc21 |
| InChI | InChI=1S/C16H18O/c1-11-12(2)16(9-5-6-13(17)10-16)15-8-4-3-7-14(11)15/h3-4,7-8H,5-6,9-10H2,1-2H3 |
| InChIKey | WXWPJVMRKNLECC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |