C18H22O2S — CID 10804341
S-phenyl 4a-(hydroxymethyl)-3,4,5,6,7,8-hexahydro-2H-naphthalene-2-carbothioate (PubChem CID 10804341) has the molecular formula C18H22O2S and a molecular weight of 302.44 g/mol. Its IUPAC name is S-phenyl 4a-(hydroxymethyl)-3,4,5,6,7,8-hexahydro-2H-naphthalene-2-carbothioate.
| Compound Name | S-phenyl 4a-(hydroxymethyl)-3,4,5,6,7,8-hexahydro-2H-naphthalene-2-carbothioate |
|---|---|
| PubChem CID | 10804341 |
| Molecular Formula | C18H22O2S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | S-phenyl 4a-(hydroxymethyl)-3,4,5,6,7,8-hexahydro-2H-naphthalene-2-carbothioate |
| SMILES | O=C(Sc1ccccc1)C1C=C2CCCCC2(CO)CC1 |
| InChI | InChI=1S/C18H22O2S/c19-13-18-10-5-4-6-15(18)12-14(9-11-18)17(20)21-16-7-2-1-3-8-16/h1-3,7-8,12,14,19H,4-6,9-11,13H2 |
| InChIKey | KDEBNAQZMHAKSY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|