C16H10FN3O5 — CID 10807295
1-[2-[3-(2,5-dioxopyrrol-1-yl)phenyl]acetyl]-5-fluoropyrimidine-2,4-dione (PubChem CID 10807295) has the molecular formula C16H10FN3O5 and a molecular weight of 343.27 g/mol. Its IUPAC name is 1-[2-[3-(2,5-dioxopyrrol-1-yl)phenyl]acetyl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[2-[3-(2,5-dioxopyrrol-1-yl)phenyl]acetyl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10807295 |
| Molecular Formula | C16H10FN3O5 |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 1-[2-[3-(2,5-dioxopyrrol-1-yl)phenyl]acetyl]-5-fluoropyrimidine-2,4-dione |
| SMILES | O=C1C=CC(=O)N1c1cccc(CC(=O)n2cc(F)c(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C16H10FN3O5/c17-11-8-19(16(25)18-15(11)24)14(23)7-9-2-1-3-10(6-9)20-12(21)4-5-13(20)22/h1-6,8H,7H2,(H,18,24,25) |
| InChIKey | ZEULMLPZSGRKPW-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 109.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|