C25H48O3Si — CID 10812279
[(1Z,3aR,4S,7aS)-1-[5-(methoxymethoxy)-5-methylhexylidene]-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10812279) has the molecular formula C25H48O3Si and a molecular weight of 424.74 g/mol. Its IUPAC name is [(1Z,3aR,4S,7aS)-1-[5-(methoxymethoxy)-5-methylhexylidene]-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1Z,3aR,4S,7aS)-1-[5-(methoxymethoxy)-5-methylhexylidene]-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10812279 |
| Molecular Formula | C25H48O3Si |
| Molecular Weight | 424.74 g/mol |
| Exact Mass | 424.34 |
| IUPAC Name | [(1Z,3aR,4S,7aS)-1-[5-(methoxymethoxy)-5-methylhexylidene]-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COCOC(C)(C)CCC/C=C1/CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C25H48O3Si/c1-23(2,3)29(8,9)28-22-14-12-18-25(6)20(15-16-21(22)25)13-10-11-17-24(4,5)27-19-26-7/h13,21-22H,10-12,14-19H2,1-9H3/b20-13-/t21-,22-,25+/m0/s1 |
| InChIKey | JBZXUXWMJBMNGM-HOTOGQNJSA-N |
| XLogP | 7.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.74 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|