C26H32ClN3O3S — CID 10815293
(E)-3-[3-chloro-4-[2-(3-morpholin-4-ylpropylamino)phenyl]sulfanylphenyl]-1-morpholin-4-ylprop-2-en-1-one (PubChem CID 10815293) has the molecular formula C26H32ClN3O3S and a molecular weight of 502.08 g/mol. Its IUPAC name is (E)-3-[3-chloro-4-[2-(3-morpholin-4-ylpropylamino)phenyl]sulfanylphenyl]-1-morpholin-4-ylprop-2-en-1-one.
| Compound Name | (E)-3-[3-chloro-4-[2-(3-morpholin-4-ylpropylamino)phenyl]sulfanylphenyl]-1-morpholin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 10815293 |
| Molecular Formula | C26H32ClN3O3S |
| Molecular Weight | 502.08 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | (E)-3-[3-chloro-4-[2-(3-morpholin-4-ylpropylamino)phenyl]sulfanylphenyl]-1-morpholin-4-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Sc2ccccc2NCCCN2CCOCC2)c(Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C26H32ClN3O3S/c27-22-20-21(7-9-26(31)30-14-18-33-19-15-30)6-8-24(22)34-25-5-2-1-4-23(25)28-10-3-11-29-12-16-32-17-13-29/h1-2,4-9,20,28H,3,10-19H2/b9-7+ |
| InChIKey | FYCLIBMUEUKVCF-VQHVLOKHSA-N |
| XLogP | 4.50 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.08 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|