C29H41NO7Si — CID 10816343
benzyl (3aS,6R,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-6-(hydroxymethyl)-2,2-dimethyl-4-phenyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate (PubChem CID 10816343) has the molecular formula C29H41NO7Si and a molecular weight of 543.73 g/mol. Its IUPAC name is benzyl (3aS,6R,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-6-(hydroxymethyl)-2,2-dimethyl-4-phenyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate.
| Compound Name | benzyl (3aS,6R,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-6-(hydroxymethyl)-2,2-dimethyl-4-phenyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 10816343 |
| Molecular Formula | C29H41NO7Si |
| Molecular Weight | 543.73 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | benzyl (3aS,6R,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-6-(hydroxymethyl)-2,2-dimethyl-4-phenyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate |
| SMILES | CC1(C)O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)N(C(=O)OCc3ccccc3)C(O)(c3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C29H41NO7Si/c1-27(2,3)38(6,7)37-23-22(18-31)30(26(32)34-19-20-14-10-8-11-15-20)29(33,21-16-12-9-13-17-21)25-24(23)35-28(4,5)36-25/h8-17,22-25,31,33H,18-19H2,1-7H3/t22-,23-,24+,25+,29?/m1/s1 |
| InChIKey | PQUBCHRKJZWGFH-BXXJIKLGSA-N |
| XLogP | 4.76 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.73 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|