C29H35N7O7 — CID 10817269
diethyl (2S)-2-[[4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)-2-nitroanilino]methyl]benzoyl]amino]pentanedioate (PubChem CID 10817269) has the molecular formula C29H35N7O7 and a molecular weight of 593.64 g/mol. Its IUPAC name is diethyl (2S)-2-[[4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)-2-nitroanilino]methyl]benzoyl]amino]pentanedioate.
| Compound Name | diethyl (2S)-2-[[4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)-2-nitroanilino]methyl]benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 10817269 |
| Molecular Formula | C29H35N7O7 |
| Molecular Weight | 593.64 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | diethyl (2S)-2-[[4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)-2-nitroanilino]methyl]benzoyl]amino]pentanedioate |
| SMILES | CCOC(=O)CC[C@H](NC(=O)c1ccc(CNc2ccc(-c3c(N)nc(N)nc3CC)cc2[N+](=O)[O-])cc1)C(=O)OCC |
| InChI | InChI=1S/C29H35N7O7/c1-4-20-25(26(30)35-29(31)34-20)19-11-12-21(23(15-19)36(40)41)32-16-17-7-9-18(10-8-17)27(38)33-22(28(39)43-6-3)13-14-24(37)42-5-2/h7-12,15,22,32H,4-6,13-14,16H2,1-3H3,(H,33,38)(H4,30,31,34,35)/t22-/m0/s1 |
| InChIKey | QHQRTRHLFGXTBK-QFIPXVFZSA-N |
| XLogP | 3.40 |
| TPSA | 214.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.64 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|