C19H19ClN6O2 — CID 14278798
5-[4-[(2-chlorophenyl)methylamino]-3-nitrophenyl]-6-ethylpyrimidine-2,4-diamine (PubChem CID 14278798) has the molecular formula C19H19ClN6O2 and a molecular weight of 398.85 g/mol. Its IUPAC name is 5-[4-[(2-chlorophenyl)methylamino]-3-nitrophenyl]-6-ethylpyrimidine-2,4-diamine.
| Compound Name | 5-[4-[(2-chlorophenyl)methylamino]-3-nitrophenyl]-6-ethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 14278798 |
| Molecular Formula | C19H19ClN6O2 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 5-[4-[(2-chlorophenyl)methylamino]-3-nitrophenyl]-6-ethylpyrimidine-2,4-diamine |
| SMILES | CCc1nc(N)nc(N)c1-c1ccc(NCc2ccccc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H19ClN6O2/c1-2-14-17(18(21)25-19(22)24-14)11-7-8-15(16(9-11)26(27)28)23-10-12-5-3-4-6-13(12)20/h3-9,23H,2,10H2,1H3,(H4,21,22,24,25) |
| InChIKey | YMNAYQDCCGHULA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 132.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|