C11H18O3 — CID 10821811
(4aS,8Z,12aR)-3,4,4a,6,7,10,12,12a-octahydro-2H-pyrano[3,2-b][1,5]dioxecine (PubChem CID 10821811) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is (4aS,8Z,12aR)-3,4,4a,6,7,10,12,12a-octahydro-2H-pyrano[3,2-b][1,5]dioxecine.
| Compound Name | (4aS,8Z,12aR)-3,4,4a,6,7,10,12,12a-octahydro-2H-pyrano[3,2-b][1,5]dioxecine |
|---|---|
| PubChem CID | 10821811 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (4aS,8Z,12aR)-3,4,4a,6,7,10,12,12a-octahydro-2H-pyrano[3,2-b][1,5]dioxecine |
| SMILES | C1=C\COC[C@H]2OCCC[C@@H]2OCC/1 |
| InChI | InChI=1S/C11H18O3/c1-2-6-12-9-11-10(13-7-3-1)5-4-8-14-11/h1-2,10-11H,3-9H2/b2-1-/t10-,11+/m0/s1 |
| InChIKey | RNBPEICRLIPTEH-WQJDUCKJSA-N |
| XLogP | 1.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|