C9H17N5S — CID 10823193
3-amino-N-hexyl-1,2,4-triazole-1-carbothioamide (PubChem CID 10823193) has the molecular formula C9H17N5S and a molecular weight of 227.34 g/mol. Its IUPAC name is 3-amino-N-hexyl-1,2,4-triazole-1-carbothioamide.
| Compound Name | 3-amino-N-hexyl-1,2,4-triazole-1-carbothioamide |
|---|---|
| PubChem CID | 10823193 |
| Molecular Formula | C9H17N5S |
| Molecular Weight | 227.34 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 3-amino-N-hexyl-1,2,4-triazole-1-carbothioamide |
| SMILES | CCCCCCNC(=S)n1cnc(N)n1 |
| InChI | InChI=1S/C9H17N5S/c1-2-3-4-5-6-11-9(15)14-7-12-8(10)13-14/h7H,2-6H2,1H3,(H2,10,13)(H,11,15) |
| InChIKey | RVJFHTSTLKLERL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|