C23H33NO6 — CID 10835873
2-[(1S)-1-[(4S,5S)-4,5-bis[(2-methylpropan-2-yl)oxymethyl]-1,3-dioxolan-2-yl]ethyl]isoindole-1,3-dione (PubChem CID 10835873) has the molecular formula C23H33NO6 and a molecular weight of 419.52 g/mol. Its IUPAC name is 2-[(1S)-1-[(4S,5S)-4,5-bis[(2-methylpropan-2-yl)oxymethyl]-1,3-dioxolan-2-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[(1S)-1-[(4S,5S)-4,5-bis[(2-methylpropan-2-yl)oxymethyl]-1,3-dioxolan-2-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10835873 |
| Molecular Formula | C23H33NO6 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 2-[(1S)-1-[(4S,5S)-4,5-bis[(2-methylpropan-2-yl)oxymethyl]-1,3-dioxolan-2-yl]ethyl]isoindole-1,3-dione |
| SMILES | C[C@@H](C1O[C@@H](COC(C)(C)C)[C@H](COC(C)(C)C)O1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H33NO6/c1-14(24-19(25)15-10-8-9-11-16(15)20(24)26)21-29-17(12-27-22(2,3)4)18(30-21)13-28-23(5,6)7/h8-11,14,17-18,21H,12-13H2,1-7H3/t14-,17-,18-/m0/s1 |
| InChIKey | BHZKGWZGUDTWCS-WBAXXEDZSA-N |
| XLogP | 3.41 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|