C28H32N2O6S — CID 10839806
ethyl 3-[5-(3-ethoxy-3-oxopropyl)-1,3-bis(4-methylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]propanoate (PubChem CID 10839806) has the molecular formula C28H32N2O6S and a molecular weight of 524.64 g/mol. Its IUPAC name is ethyl 3-[5-(3-ethoxy-3-oxopropyl)-1,3-bis(4-methylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]propanoate.
| Compound Name | ethyl 3-[5-(3-ethoxy-3-oxopropyl)-1,3-bis(4-methylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]propanoate |
|---|---|
| PubChem CID | 10839806 |
| Molecular Formula | C28H32N2O6S |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | ethyl 3-[5-(3-ethoxy-3-oxopropyl)-1,3-bis(4-methylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]propanoate |
| SMILES | CCOC(=O)CCC1(CCC(=O)OCC)C(=O)N(c2ccc(C)cc2)C(=S)N(c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C28H32N2O6S/c1-5-35-23(31)15-17-28(18-16-24(32)36-6-2)25(33)29(21-11-7-19(3)8-12-21)27(37)30(26(28)34)22-13-9-20(4)10-14-22/h7-14H,5-6,15-18H2,1-4H3 |
| InChIKey | BIMHHWSAOZQJCB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|