C31H48O11Si — CID 10841625
tetramethyl (3E,8E)-10-[2-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-methoxycarbonylcyclopropyl]deca-3,8-diene-1,1,6,6-tetracarboxylate (PubChem CID 10841625) has the molecular formula C31H48O11Si and a molecular weight of 624.80 g/mol. Its IUPAC name is tetramethyl (3E,8E)-10-[2-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-methoxycarbonylcyclopropyl]deca-3,8-diene-1,1,6,6-tetracarboxylate.
| Compound Name | tetramethyl (3E,8E)-10-[2-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-methoxycarbonylcyclopropyl]deca-3,8-diene-1,1,6,6-tetracarboxylate |
|---|---|
| PubChem CID | 10841625 |
| Molecular Formula | C31H48O11Si |
| Molecular Weight | 624.80 g/mol |
| Exact Mass | 624.30 |
| IUPAC Name | tetramethyl (3E,8E)-10-[2-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-methoxycarbonylcyclopropyl]deca-3,8-diene-1,1,6,6-tetracarboxylate |
| SMILES | C=CC1(O[Si](C)(C)C(C)(C)C)CC1(C/C=C/CC(C/C=C/CC(C(=O)OC)C(=O)OC)(C(=O)OC)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C31H48O11Si/c1-12-31(42-43(10,11)28(2,3)4)21-30(31,27(36)41-9)20-16-15-19-29(25(34)39-7,26(35)40-8)18-14-13-17-22(23(32)37-5)24(33)38-6/h12-16,22H,1,17-21H2,2-11H3/b14-13+,16-15+ |
| InChIKey | WOJJMWDBDXRIHO-ZBMVRHCNSA-N |
| XLogP | 4.46 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.80 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|