C12H11N3O4 — CID 10848969
3-azido-4-(3,4-dimethoxyphenyl)-2H-furan-5-one (PubChem CID 10848969) has the molecular formula C12H11N3O4 and a molecular weight of 261.24 g/mol. Its IUPAC name is 3-azido-4-(3,4-dimethoxyphenyl)-2H-furan-5-one.
| Compound Name | 3-azido-4-(3,4-dimethoxyphenyl)-2H-furan-5-one |
|---|---|
| PubChem CID | 10848969 |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 3-azido-4-(3,4-dimethoxyphenyl)-2H-furan-5-one |
| SMILES | COc1ccc(C2=C(N=[N+]=[N-])COC2=O)cc1OC |
| InChI | InChI=1S/C12H11N3O4/c1-17-9-4-3-7(5-10(9)18-2)11-8(14-15-13)6-19-12(11)16/h3-5H,6H2,1-2H3 |
| InChIKey | DTFJHNZQRXVVQL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|