C14H15BrO5 — CID 141343674
3-(2-bromoethoxy)-4-(3,4-dimethoxyphenyl)-2H-furan-5-one (PubChem CID 141343674) has the molecular formula C14H15BrO5 and a molecular weight of 343.17 g/mol. Its IUPAC name is 3-(2-bromoethoxy)-4-(3,4-dimethoxyphenyl)-2H-furan-5-one.
| Compound Name | 3-(2-bromoethoxy)-4-(3,4-dimethoxyphenyl)-2H-furan-5-one |
|---|---|
| PubChem CID | 141343674 |
| Molecular Formula | C14H15BrO5 |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 3-(2-bromoethoxy)-4-(3,4-dimethoxyphenyl)-2H-furan-5-one |
| SMILES | COc1ccc(C2=C(OCCBr)COC2=O)cc1OC |
| InChI | InChI=1S/C14H15BrO5/c1-17-10-4-3-9(7-11(10)18-2)13-12(19-6-5-15)8-20-14(13)16/h3-4,7H,5-6,8H2,1-2H3 |
| InChIKey | HGIQCHJAMXMXGV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|