C19H19NO5 — CID 139081940
4-(3,4-dimethoxyphenyl)-3-(2-methoxyanilino)-2H-furan-5-one (PubChem CID 139081940) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-3-(2-methoxyanilino)-2H-furan-5-one.
| Compound Name | 4-(3,4-dimethoxyphenyl)-3-(2-methoxyanilino)-2H-furan-5-one |
|---|---|
| PubChem CID | 139081940 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-3-(2-methoxyanilino)-2H-furan-5-one |
| SMILES | COc1ccccc1NC1=C(c2ccc(OC)c(OC)c2)C(=O)OC1 |
| InChI | InChI=1S/C19H19NO5/c1-22-15-7-5-4-6-13(15)20-14-11-25-19(21)18(14)12-8-9-16(23-2)17(10-12)24-3/h4-10,20H,11H2,1-3H3 |
| InChIKey | DMCCCQLTRVCPDP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |