C12H19BrO2 — CID 10849980
(7E)-7-(bromomethyl)-1,4-dioxaspiro[4.8]tridec-7-ene (PubChem CID 10849980) has the molecular formula C12H19BrO2 and a molecular weight of 275.19 g/mol. Its IUPAC name is (7E)-7-(bromomethyl)-1,4-dioxaspiro[4.8]tridec-7-ene.
| Compound Name | (7E)-7-(bromomethyl)-1,4-dioxaspiro[4.8]tridec-7-ene |
|---|---|
| PubChem CID | 10849980 |
| Molecular Formula | C12H19BrO2 |
| Molecular Weight | 275.19 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | (7E)-7-(bromomethyl)-1,4-dioxaspiro[4.8]tridec-7-ene |
| SMILES | BrC/C1=C/CCCCCC2(C1)OCCO2 |
| InChI | InChI=1S/C12H19BrO2/c13-10-11-5-3-1-2-4-6-12(9-11)14-7-8-15-12/h5H,1-4,6-10H2/b11-5+ |
| InChIKey | APOLXEINTROHJD-VZUCSPMQSA-N |
| XLogP | 3.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.19 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|