C14H20N2O4 — CID 108509946
N-(3,5-dimethylphenyl)-N',N'-bis(2-hydroxyethyl)oxamide (PubChem CID 108509946) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-N',N'-bis(2-hydroxyethyl)oxamide.
| Compound Name | N-(3,5-dimethylphenyl)-N',N'-bis(2-hydroxyethyl)oxamide |
|---|---|
| PubChem CID | 108509946 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | N-(3,5-dimethylphenyl)-N',N'-bis(2-hydroxyethyl)oxamide |
| SMILES | Cc1cc(C)cc(NC(=O)C(=O)N(CCO)CCO)c1 |
| InChI | InChI=1S/C14H20N2O4/c1-10-7-11(2)9-12(8-10)15-13(19)14(20)16(3-5-17)4-6-18/h7-9,17-18H,3-6H2,1-2H3,(H,15,19) |
| InChIKey | OWTGPLMBARFXBL-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|