C20H21ClN2O5 — CID 108541794
N-[2-[4-(2-chlorophenoxy)butanoylamino]ethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 108541794) has the molecular formula C20H21ClN2O5 and a molecular weight of 404.85 g/mol. Its IUPAC name is N-[2-[4-(2-chlorophenoxy)butanoylamino]ethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-[4-(2-chlorophenoxy)butanoylamino]ethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 108541794 |
| Molecular Formula | C20H21ClN2O5 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | N-[2-[4-(2-chlorophenoxy)butanoylamino]ethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(CCCOc1ccccc1Cl)NCCNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H21ClN2O5/c21-15-4-1-2-5-16(15)26-11-3-6-19(24)22-9-10-23-20(25)14-7-8-17-18(12-14)28-13-27-17/h1-2,4-5,7-8,12H,3,6,9-11,13H2,(H,22,24)(H,23,25) |
| InChIKey | PWBJMWLOWFSTSL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|