C19H32O6Si — CID 10861939
dimethyl (3aS,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-1,3,3a,4,6,6a-hexahydropentalene-2,2-dicarboxylate (PubChem CID 10861939) has the molecular formula C19H32O6Si and a molecular weight of 384.55 g/mol. Its IUPAC name is dimethyl (3aS,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-1,3,3a,4,6,6a-hexahydropentalene-2,2-dicarboxylate.
| Compound Name | dimethyl (3aS,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-1,3,3a,4,6,6a-hexahydropentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 10861939 |
| Molecular Formula | C19H32O6Si |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | dimethyl (3aS,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-1,3,3a,4,6,6a-hexahydropentalene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2CC(=O)[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H]2C1 |
| InChI | InChI=1S/C19H32O6Si/c1-18(2,3)26(6,7)25-11-14-13-10-19(16(21)23-4,17(22)24-5)9-12(13)8-15(14)20/h12-14H,8-11H2,1-7H3/t12?,13-,14-/m0/s1 |
| InChIKey | NHHCPPFWEZQRNX-TTZKSVMKSA-N |
| XLogP | 2.96 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|