C20H26O6 — CID 10864042
[(3R,4S,5E,7E,9R)-9-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-3-methylundeca-1,5,7,10-tetraen-4-yl] acetate (PubChem CID 10864042) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is [(3R,4S,5E,7E,9R)-9-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-3-methylundeca-1,5,7,10-tetraen-4-yl] acetate.
| Compound Name | [(3R,4S,5E,7E,9R)-9-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-3-methylundeca-1,5,7,10-tetraen-4-yl] acetate |
|---|---|
| PubChem CID | 10864042 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [(3R,4S,5E,7E,9R)-9-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-3-methylundeca-1,5,7,10-tetraen-4-yl] acetate |
| SMILES | C=C[C@H](/C=C/C=C/[C@H](OC(C)=O)[C@H](C)C=C)C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C20H26O6/c1-7-13(3)16(24-14(4)21)12-10-9-11-15(8-2)17-18(22)25-20(5,6)26-19(17)23/h7-13,15-17H,1-2H2,3-6H3/b11-9+,12-10+/t13-,15-,16+/m1/s1 |
| InChIKey | VEBIWUDBRLTBOP-IMYPEFJISA-N |
| XLogP | 3.11 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|