C17H28F3N3O4 — CID 10872948
tert-butyl (2S)-1-[(2S)-2-amino-6-[(2,2,2-trifluoroacetyl)amino]hexanoyl]pyrrolidine-2-carboxylate (PubChem CID 10872948) has the molecular formula C17H28F3N3O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is tert-butyl (2S)-1-[(2S)-2-amino-6-[(2,2,2-trifluoroacetyl)amino]hexanoyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[(2S)-2-amino-6-[(2,2,2-trifluoroacetyl)amino]hexanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 10872948 |
| Molecular Formula | C17H28F3N3O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | tert-butyl (2S)-1-[(2S)-2-amino-6-[(2,2,2-trifluoroacetyl)amino]hexanoyl]pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CCCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H28F3N3O4/c1-16(2,3)27-14(25)12-8-6-10-23(12)13(24)11(21)7-4-5-9-22-15(26)17(18,19)20/h11-12H,4-10,21H2,1-3H3,(H,22,26)/t11-,12-/m0/s1 |
| InChIKey | KHGKVOXQTIMODM-RYUDHWBXSA-N |
| XLogP | 1.50 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|