C22H16N4O5 — CID 10873422
ethyl 4-amino-6-cyano-2-methyl-3-(3-oxochromeno[2,3-c]pyrazole-2-carbonyl)benzoate (PubChem CID 10873422) has the molecular formula C22H16N4O5 and a molecular weight of 416.39 g/mol. Its IUPAC name is ethyl 4-amino-6-cyano-2-methyl-3-(3-oxochromeno[2,3-c]pyrazole-2-carbonyl)benzoate.
| Compound Name | ethyl 4-amino-6-cyano-2-methyl-3-(3-oxochromeno[2,3-c]pyrazole-2-carbonyl)benzoate |
|---|---|
| PubChem CID | 10873422 |
| Molecular Formula | C22H16N4O5 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | ethyl 4-amino-6-cyano-2-methyl-3-(3-oxochromeno[2,3-c]pyrazole-2-carbonyl)benzoate |
| SMILES | CCOC(=O)c1c(C#N)cc(N)c(C(=O)n2nc3oc4ccccc4cc-3c2=O)c1C |
| InChI | InChI=1S/C22H16N4O5/c1-3-30-22(29)17-11(2)18(15(24)9-13(17)10-23)21(28)26-20(27)14-8-12-6-4-5-7-16(12)31-19(14)25-26/h4-9H,3,24H2,1-2H3 |
| InChIKey | HABXTZLMFSSXBA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 141.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|