C17H16N2O6 — CID 11824115
diethyl 2-(3-oxochromeno[2,3-c]pyrazol-2-yl)propanedioate (PubChem CID 11824115) has the molecular formula C17H16N2O6 and a molecular weight of 344.32 g/mol. Its IUPAC name is diethyl 2-(3-oxochromeno[2,3-c]pyrazol-2-yl)propanedioate.
| Compound Name | diethyl 2-(3-oxochromeno[2,3-c]pyrazol-2-yl)propanedioate |
|---|---|
| PubChem CID | 11824115 |
| Molecular Formula | C17H16N2O6 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | diethyl 2-(3-oxochromeno[2,3-c]pyrazol-2-yl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)n1nc2oc3ccccc3cc-2c1=O |
| InChI | InChI=1S/C17H16N2O6/c1-3-23-16(21)13(17(22)24-4-2)19-15(20)11-9-10-7-5-6-8-12(10)25-14(11)18-19/h5-9,13H,3-4H2,1-2H3 |
| InChIKey | KYUSTKXETWGLJT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 100.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|