C22H17N3O7 — CID 108740668
N-(4-acetyl-3-carbamoyl-5-methylfuran-2-yl)-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 108740668) has the molecular formula C22H17N3O7 and a molecular weight of 435.39 g/mol. Its IUPAC name is N-(4-acetyl-3-carbamoyl-5-methylfuran-2-yl)-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-(4-acetyl-3-carbamoyl-5-methylfuran-2-yl)-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 108740668 |
| Molecular Formula | C22H17N3O7 |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | N-(4-acetyl-3-carbamoyl-5-methylfuran-2-yl)-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CC(=O)c1c(C)oc(NC(=O)c2ccc3c(c2)C(=O)N(Cc2ccco2)C3=O)c1C(N)=O |
| InChI | InChI=1S/C22H17N3O7/c1-10(26)16-11(2)32-20(17(16)18(23)27)24-19(28)12-5-6-14-15(8-12)22(30)25(21(14)29)9-13-4-3-7-31-13/h3-8H,9H2,1-2H3,(H2,23,27)(H,24,28) |
| InChIKey | BWXDPTMGXIHDCY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 152.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|