C33H42O5Si — CID 10875280
diethyl (3aR,7S,8aS)-7-[tert-butyl(diphenyl)silyl]oxy-3-methylidene-2,3a,6,7,8,8a-hexahydroazulene-1,1-dicarboxylate (PubChem CID 10875280) has the molecular formula C33H42O5Si and a molecular weight of 546.78 g/mol. Its IUPAC name is diethyl (3aR,7S,8aS)-7-[tert-butyl(diphenyl)silyl]oxy-3-methylidene-2,3a,6,7,8,8a-hexahydroazulene-1,1-dicarboxylate.
| Compound Name | diethyl (3aR,7S,8aS)-7-[tert-butyl(diphenyl)silyl]oxy-3-methylidene-2,3a,6,7,8,8a-hexahydroazulene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10875280 |
| Molecular Formula | C33H42O5Si |
| Molecular Weight | 546.78 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | diethyl (3aR,7S,8aS)-7-[tert-butyl(diphenyl)silyl]oxy-3-methylidene-2,3a,6,7,8,8a-hexahydroazulene-1,1-dicarboxylate |
| SMILES | C=C1CC(C(=O)OCC)(C(=O)OCC)[C@H]2C[C@@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CC=C[C@@H]12 |
| InChI | InChI=1S/C33H42O5Si/c1-7-36-30(34)33(31(35)37-8-2)23-24(3)28-21-15-16-25(22-29(28)33)38-39(32(4,5)6,26-17-11-9-12-18-26)27-19-13-10-14-20-27/h9-15,17-21,25,28-29H,3,7-8,16,22-23H2,1-2,4-6H3/t25-,28-,29-/m0/s1 |
| InChIKey | FSFOCATWDNXZFX-FMYROPPKSA-N |
| XLogP | 5.59 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.78 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|