C22H24Cl2N2O3S — CID 108759376
(E)-N-[2-[4-(cyclopentylsulfamoyl)phenyl]ethyl]-3-(3,4-dichlorophenyl)prop-2-enamide (PubChem CID 108759376) has the molecular formula C22H24Cl2N2O3S and a molecular weight of 467.42 g/mol. Its IUPAC name is (E)-N-[2-[4-(cyclopentylsulfamoyl)phenyl]ethyl]-3-(3,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-[4-(cyclopentylsulfamoyl)phenyl]ethyl]-3-(3,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108759376 |
| Molecular Formula | C22H24Cl2N2O3S |
| Molecular Weight | 467.42 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | (E)-N-[2-[4-(cyclopentylsulfamoyl)phenyl]ethyl]-3-(3,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCc1ccc(S(=O)(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C22H24Cl2N2O3S/c23-20-11-7-17(15-21(20)24)8-12-22(27)25-14-13-16-5-9-19(10-6-16)30(28,29)26-18-3-1-2-4-18/h5-12,15,18,26H,1-4,13-14H2,(H,25,27)/b12-8+ |
| InChIKey | CYUMTXKZIDZSST-XYOKQWHBSA-N |
| XLogP | 4.59 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|