C12H19ClO2 — CID 10878980
(2E,4E,6E)-8-chloro-1,1-dimethoxy-3,7-dimethylocta-2,4,6-triene (PubChem CID 10878980) has the molecular formula C12H19ClO2 and a molecular weight of 230.73 g/mol. Its IUPAC name is (2E,4E,6E)-8-chloro-1,1-dimethoxy-3,7-dimethylocta-2,4,6-triene.
| Compound Name | (2E,4E,6E)-8-chloro-1,1-dimethoxy-3,7-dimethylocta-2,4,6-triene |
|---|---|
| PubChem CID | 10878980 |
| Molecular Formula | C12H19ClO2 |
| Molecular Weight | 230.73 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | (2E,4E,6E)-8-chloro-1,1-dimethoxy-3,7-dimethylocta-2,4,6-triene |
| SMILES | COC(/C=C(C)/C=C/C=C(\C)CCl)OC |
| InChI | InChI=1S/C12H19ClO2/c1-10(8-12(14-3)15-4)6-5-7-11(2)9-13/h5-8,12H,9H2,1-4H3/b6-5+,10-8+,11-7+ |
| InChIKey | YILXOVVFVUQPRX-DDUXJWAXSA-N |
| XLogP | 3.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.73 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|