C14H26O2Si — CID 10879669
(1S,3aR,4R,6aR)-4-[tert-butyl(dimethyl)silyl]oxy-1,3a,4,5,6,6a-hexahydropentalen-1-ol (PubChem CID 10879669) has the molecular formula C14H26O2Si and a molecular weight of 254.45 g/mol. Its IUPAC name is (1S,3aR,4R,6aR)-4-[tert-butyl(dimethyl)silyl]oxy-1,3a,4,5,6,6a-hexahydropentalen-1-ol.
| Compound Name | (1S,3aR,4R,6aR)-4-[tert-butyl(dimethyl)silyl]oxy-1,3a,4,5,6,6a-hexahydropentalen-1-ol |
|---|---|
| PubChem CID | 10879669 |
| Molecular Formula | C14H26O2Si |
| Molecular Weight | 254.45 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | (1S,3aR,4R,6aR)-4-[tert-butyl(dimethyl)silyl]oxy-1,3a,4,5,6,6a-hexahydropentalen-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC[C@@H]2[C@H]1C=C[C@@H]2O |
| InChI | InChI=1S/C14H26O2Si/c1-14(2,3)17(4,5)16-13-9-7-10-11(13)6-8-12(10)15/h6,8,10-13,15H,7,9H2,1-5H3/t10-,11-,12+,13-/m1/s1 |
| InChIKey | FAYGCHNMQPELOJ-FVCCEPFGSA-N |
| XLogP | 3.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|