C23H31NO2 — CID 10882733
(8S,9R,10S,13S,14S,17E)-17-(1-isocyanoethylidene)-3-methoxy-10,13-dimethyl-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-9-ol (PubChem CID 10882733) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is (8S,9R,10S,13S,14S,17E)-17-(1-isocyanoethylidene)-3-methoxy-10,13-dimethyl-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-9-ol.
| Compound Name | (8S,9R,10S,13S,14S,17E)-17-(1-isocyanoethylidene)-3-methoxy-10,13-dimethyl-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-9-ol |
|---|---|
| PubChem CID | 10882733 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | (8S,9R,10S,13S,14S,17E)-17-(1-isocyanoethylidene)-3-methoxy-10,13-dimethyl-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-9-ol |
| SMILES | [C-]#[N+]/C(C)=C1\CC[C@H]2[C@@H]3CC=C4C=C(OC)CC[C@]4(C)[C@@]3(O)CC[C@]12C |
| InChI | InChI=1S/C23H31NO2/c1-15(24-4)18-8-9-19-20-7-6-16-14-17(26-5)10-11-22(16,3)23(20,25)13-12-21(18,19)2/h6,14,19-20,25H,7-13H2,1-3,5H3/b18-15+/t19-,20-,21+,22-,23+/m0/s1 |
| InChIKey | NWBGSVKGZFLAHE-ARGYAAQZSA-N |
| XLogP | 5.40 |
| TPSA | 33.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|