C12H15BrN4O — CID 108912714
1-(5-bromopyrimidin-2-yl)-3-(cyclohexylidenemethyl)urea (PubChem CID 108912714) has the molecular formula C12H15BrN4O and a molecular weight of 311.18 g/mol. Its IUPAC name is 1-(5-bromopyrimidin-2-yl)-3-(cyclohexylidenemethyl)urea.
| Compound Name | 1-(5-bromopyrimidin-2-yl)-3-(cyclohexylidenemethyl)urea |
|---|---|
| PubChem CID | 108912714 |
| Molecular Formula | C12H15BrN4O |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 1-(5-bromopyrimidin-2-yl)-3-(cyclohexylidenemethyl)urea |
| SMILES | O=C(NC=C1CCCCC1)Nc1ncc(Br)cn1 |
| InChI | InChI=1S/C12H15BrN4O/c13-10-7-14-11(15-8-10)17-12(18)16-6-9-4-2-1-3-5-9/h6-8H,1-5H2,(H2,14,15,16,17,18) |
| InChIKey | RZCUQFQALSXCOV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |