About phenanthrene-3-diazonium hexafluorophosphate
phenanthrene-3-diazonium hexafluorophosphate (PubChem CID 10893474) has the molecular formula C14H9F6N2P
and a molecular weight of 350.20 g/mol. Its IUPAC name is phenanthrene-3-diazonium hexafluorophosphate.
Molecular Properties
| Compound Name | phenanthrene-3-diazonium hexafluorophosphate |
| PubChem CID | 10893474 |
| Molecular Formula | C14H9F6N2P |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | phenanthrene-3-diazonium hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.N#[N+]c1ccc2ccc3ccccc3c2c1 |
| InChI | InChI=1S/C14H9N2.F6P/c15-16-12-8-7-11-6-5-10-3-1-2-4-13(10)14(11)9-12;1-7(2,3,4,5)6/h1-9H;/q+1;-1 |
| InChIKey | HKFFHKYBVGYKPA-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze phenanthrene-3-diazonium hexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthrene-3-diazonium hexafluorophosphate?
The IUPAC name of phenanthrene-3-diazonium hexafluorophosphate (CID 10893474) is phenanthrene-3-diazonium hexafluorophosphate.
What is the SMILES notation for phenanthrene-3-diazonium hexafluorophosphate?
The canonical SMILES for phenanthrene-3-diazonium hexafluorophosphate is F[P-](F)(F)(F)(F)F.N#[N+]c1ccc2ccc3ccccc3c2c1.
What is the InChIKey of phenanthrene-3-diazonium hexafluorophosphate?
The InChIKey is HKFFHKYBVGYKPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N2.F6P/c15-16-12-8-7-11-6-5-10-3-1-2-4-13(10)14(11)9-12;1-7(2,3,4,5)6/h1-9H;/q+1;-1.
What are the key properties of phenanthrene-3-diazonium hexafluorophosphate?
phenanthrene-3-diazonium hexafluorophosphate has a molecular weight of 350.20 g/mol, XLogP of 7.86, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthrene-3-diazonium hexafluorophosphate is sourced from PubChem (CID 10893474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).