C17H31IO4 — CID 10895187
2-[(2R,3S)-3-(1,3-dioxolan-2-ylmethyl)-5-iodo-2-methylpentyl]-2-(2-methylpropyl)-1,3-dioxolane (PubChem CID 10895187) has the molecular formula C17H31IO4 and a molecular weight of 426.34 g/mol. Its IUPAC name is 2-[(2R,3S)-3-(1,3-dioxolan-2-ylmethyl)-5-iodo-2-methylpentyl]-2-(2-methylpropyl)-1,3-dioxolane.
| Compound Name | 2-[(2R,3S)-3-(1,3-dioxolan-2-ylmethyl)-5-iodo-2-methylpentyl]-2-(2-methylpropyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 10895187 |
| Molecular Formula | C17H31IO4 |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 2-[(2R,3S)-3-(1,3-dioxolan-2-ylmethyl)-5-iodo-2-methylpentyl]-2-(2-methylpropyl)-1,3-dioxolane |
| SMILES | CC(C)CC1(C[C@@H](C)[C@H](CCI)CC2OCCO2)OCCO1 |
| InChI | InChI=1S/C17H31IO4/c1-13(2)11-17(21-8-9-22-17)12-14(3)15(4-5-18)10-16-19-6-7-20-16/h13-16H,4-12H2,1-3H3/t14-,15-/m1/s1 |
| InChIKey | AHEUSAFNDOQKMF-HUUCEWRRSA-N |
| XLogP | 4.01 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|