C27H37N5O2 — CID 10895876
3-(diaminomethylideneamino)-N-[(1R,4S,5S,7S)-5-(3-hydroxyphenyl)-4-methyl-2-(2-phenylethyl)-2-azabicyclo[3.3.1]nonan-7-yl]propanamide (PubChem CID 10895876) has the molecular formula C27H37N5O2 and a molecular weight of 463.63 g/mol. Its IUPAC name is 3-(diaminomethylideneamino)-N-[(1R,4S,5S,7S)-5-(3-hydroxyphenyl)-4-methyl-2-(2-phenylethyl)-2-azabicyclo[3.3.1]nonan-7-yl]propanamide.
| Compound Name | 3-(diaminomethylideneamino)-N-[(1R,4S,5S,7S)-5-(3-hydroxyphenyl)-4-methyl-2-(2-phenylethyl)-2-azabicyclo[3.3.1]nonan-7-yl]propanamide |
|---|---|
| PubChem CID | 10895876 |
| Molecular Formula | C27H37N5O2 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | 3-(diaminomethylideneamino)-N-[(1R,4S,5S,7S)-5-(3-hydroxyphenyl)-4-methyl-2-(2-phenylethyl)-2-azabicyclo[3.3.1]nonan-7-yl]propanamide |
| SMILES | C[C@@H]1CN(CCc2ccccc2)[C@H]2C[C@@H](NC(=O)CCN=C(N)N)C[C@]1(c1cccc(O)c1)C2 |
| InChI | InChI=1S/C27H37N5O2/c1-19-18-32(13-11-20-6-3-2-4-7-20)23-15-22(31-25(34)10-12-30-26(28)29)16-27(19,17-23)21-8-5-9-24(33)14-21/h2-9,14,19,22-23,33H,10-13,15-18H2,1H3,(H,31,34)(H4,28,29,30)/t19-,22-,23+,27+/m1/s1 |
| InChIKey | CANLYCCFEOWQDM-JYYLQKJRSA-N |
| XLogP | 2.53 |
| TPSA | 116.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|